C28H56N6O — CID 72625961
6-[1-(2-adamantyl)ethylamino]-2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]hexanamide (PubChem CID 72625961) has the molecular formula C28H56N6O and a molecular weight of 492.80 g/mol. Its IUPAC name is 6-[1-(2-adamantyl)ethylamino]-2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]hexanamide.
| Compound Name | 6-[1-(2-adamantyl)ethylamino]-2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]hexanamide |
|---|---|
| PubChem CID | 72625961 |
| Molecular Formula | C28H56N6O |
| Molecular Weight | 492.80 g/mol |
| Exact Mass | 492.45 |
| IUPAC Name | 6-[1-(2-adamantyl)ethylamino]-2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]hexanamide |
| SMILES | CC(NCCCCC(N)C(=O)NCCCNCCCCNCCCN)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C28H56N6O/c1-21(27-24-17-22-16-23(19-24)20-25(27)18-22)33-14-3-2-8-26(30)28(35)34-15-7-13-32-11-5-4-10-31-12-6-9-29/h21-27,31-33H,2-20,29-30H2,1H3,(H,34,35) |
| InChIKey | JCIFKYIDSHLPKM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.80 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|