C14H32N6O2 — CID 57079658
(2S)-2,6-diamino-N-[2-[[(2S)-2,6-diaminohexanoyl]amino]ethyl]hexanamide (PubChem CID 57079658) has the molecular formula C14H32N6O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[2-[[(2S)-2,6-diaminohexanoyl]amino]ethyl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[2-[[(2S)-2,6-diaminohexanoyl]amino]ethyl]hexanamide |
|---|---|
| PubChem CID | 57079658 |
| Molecular Formula | C14H32N6O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | (2S)-2,6-diamino-N-[2-[[(2S)-2,6-diaminohexanoyl]amino]ethyl]hexanamide |
| SMILES | NCCCC[C@H](N)C(=O)NCCNC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C14H32N6O2/c15-7-3-1-5-11(17)13(21)19-9-10-20-14(22)12(18)6-2-4-8-16/h11-12H,1-10,15-18H2,(H,19,21)(H,20,22)/t11-,12-/m0/s1 |
| InChIKey | VYDUSBLFVXIHSJ-RYUDHWBXSA-N |
| XLogP | -1.87 |
| TPSA | 162.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|