C11H21N3O7 — CID 87503030
3-[[(2S)-2,6-diaminohexanoyl]amino]propanoic acid;oxalic acid (PubChem CID 87503030) has the molecular formula C11H21N3O7 and a molecular weight of 307.30 g/mol. Its IUPAC name is 3-[[(2S)-2,6-diaminohexanoyl]amino]propanoic acid;oxalic acid.
| Compound Name | 3-[[(2S)-2,6-diaminohexanoyl]amino]propanoic acid;oxalic acid |
|---|---|
| PubChem CID | 87503030 |
| Molecular Formula | C11H21N3O7 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 3-[[(2S)-2,6-diaminohexanoyl]amino]propanoic acid;oxalic acid |
| SMILES | NCCCC[C@H](N)C(=O)NCCC(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C9H19N3O3.C2H2O4/c10-5-2-1-3-7(11)9(15)12-6-4-8(13)14;3-1(4)2(5)6/h7H,1-6,10-11H2,(H,12,15)(H,13,14);(H,3,4)(H,5,6)/t7-;/m0./s1 |
| InChIKey | XZBDHOMLASANJZ-FJXQXJEOSA-N |
| XLogP | -1.81 |
| TPSA | 193.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|