C13H26N4O7 — CID 174603133
2-aminobutanedioic acid;3-(2,6-diaminohexanoylamino)propanoic acid (PubChem CID 174603133) has the molecular formula C13H26N4O7 and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-aminobutanedioic acid;3-(2,6-diaminohexanoylamino)propanoic acid.
| Compound Name | 2-aminobutanedioic acid;3-(2,6-diaminohexanoylamino)propanoic acid |
|---|---|
| PubChem CID | 174603133 |
| Molecular Formula | C13H26N4O7 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2-aminobutanedioic acid;3-(2,6-diaminohexanoylamino)propanoic acid |
| SMILES | NC(CC(=O)O)C(=O)O.NCCCCC(N)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C9H19N3O3.C4H7NO4/c10-5-2-1-3-7(11)9(15)12-6-4-8(13)14;5-2(4(8)9)1-3(6)7/h7H,1-6,10-11H2,(H,12,15)(H,13,14);2H,1,5H2,(H,6,7)(H,8,9) |
| InChIKey | XOTGUXOPMICPOX-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 219.06 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|