C7H12N2O5 — CID 7019995
(3S)-3-amino-4-(2-carboxyethylamino)-4-oxobutanoic acid (PubChem CID 7019995) has the molecular formula C7H12N2O5 and a molecular weight of 204.18 g/mol. Its IUPAC name is (3S)-3-amino-4-(2-carboxyethylamino)-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-(2-carboxyethylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 7019995 |
| Molecular Formula | C7H12N2O5 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | (3S)-3-amino-4-(2-carboxyethylamino)-4-oxobutanoic acid |
| SMILES | N[C@@H](CC(=O)O)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C7H12N2O5/c8-4(3-6(12)13)7(14)9-2-1-5(10)11/h4H,1-3,8H2,(H,9,14)(H,10,11)(H,12,13)/t4-/m0/s1 |
| InChIKey | QEBITXUQTVPCSL-BYPYZUCNSA-N |
| XLogP | -1.62 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |