C11H21N3O4 — CID 175463693
3-[(6-acetamido-2-aminohexanoyl)amino]propanoic acid (PubChem CID 175463693) has the molecular formula C11H21N3O4 and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-[(6-acetamido-2-aminohexanoyl)amino]propanoic acid.
| Compound Name | 3-[(6-acetamido-2-aminohexanoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 175463693 |
| Molecular Formula | C11H21N3O4 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 3-[(6-acetamido-2-aminohexanoyl)amino]propanoic acid |
| SMILES | CC(=O)NCCCCC(N)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C11H21N3O4/c1-8(15)13-6-3-2-4-9(12)11(18)14-7-5-10(16)17/h9H,2-7,12H2,1H3,(H,13,15)(H,14,18)(H,16,17) |
| InChIKey | YSUZSPCOUVIXIS-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|