C13H25N3O4 — CID 153498701
3-[[6-(acetylamino)-2-(dimethylamino)(613C)hexanoyl](15N)amino](313C)propanoic acid (PubChem CID 153498701) has the molecular formula C13H25N3O4 and a molecular weight of 292.32 g/mol. Its IUPAC name is 3-[[6-(acetylamino)-2-(dimethylamino)(613C)hexanoyl](15N)amino](313C)propanoic acid.
| Compound Name | 3-[[6-(acetylamino)-2-(dimethylamino)(613C)hexanoyl](15N)amino](313C)propanoic acid |
|---|---|
| PubChem CID | 153498701 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 3-[[6-(acetylamino)-2-(dimethylamino)(613C)hexanoyl](15N)amino](313C)propanoic acid |
| SMILES | CN(C)C(CCC[13CH2]N[13C]([13CH3])=O)C(=O)[15NH][13CH2]CC(=O)O |
| InChI | InChI=1S/C13H25N3O4/c1-10(17)14-8-5-4-6-11(16(2)3)13(20)15-9-7-12(18)19/h11H,4-9H2,1-3H3,(H,14,17)(H,15,20)(H,18,19)/i1+1,8+1,9+1,10+1,15+1 |
| InChIKey | FFQFYCSYTGDOLX-PAAGACHBSA-N |
| XLogP | -0.19 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|