C17H28N4O9S — CID 162702211
1-[3-[[6-(acetylamino)-2-(dimethylamino)(613C)hexanoyl](15N)amino]propanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid (PubChem CID 162702211) has the molecular formula C17H28N4O9S and a molecular weight of 468.47 g/mol. Its IUPAC name is 1-[3-[[6-(acetylamino)-2-(dimethylamino)(613C)hexanoyl](15N)amino]propanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid.
| Compound Name | 1-[3-[[6-(acetylamino)-2-(dimethylamino)(613C)hexanoyl](15N)amino]propanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 162702211 |
| Molecular Formula | C17H28N4O9S |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 1-[3-[[6-(acetylamino)-2-(dimethylamino)(613C)hexanoyl](15N)amino]propanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
| SMILES | CN(C)C(CCC[13CH2]N[13C]([13CH3])=O)C(=O)[15NH]CCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C17H28N4O9S/c1-11(22)18-8-5-4-6-12(20(2)3)16(25)19-9-7-15(24)30-21-14(23)10-13(17(21)26)31(27,28)29/h12-13H,4-10H2,1-3H3,(H,18,22)(H,19,25)(H,27,28,29)/i1+1,8+1,11+1,19+1 |
| InChIKey | KMUHZQQCZDGELA-WFRNWJIBSA-N |
| XLogP | -1.80 |
| TPSA | 179.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|