C21H35N3O8S — CID 163547039
(3-methylsulfonyl-2,5-dioxopyrrolidin-1-yl) 12-acetamido-8-(dimethylamino)-7-oxododecanoate (PubChem CID 163547039) has the molecular formula C21H35N3O8S and a molecular weight of 489.59 g/mol. Its IUPAC name is (3-methylsulfonyl-2,5-dioxopyrrolidin-1-yl) 12-acetamido-8-(dimethylamino)-7-oxododecanoate.
| Compound Name | (3-methylsulfonyl-2,5-dioxopyrrolidin-1-yl) 12-acetamido-8-(dimethylamino)-7-oxododecanoate |
|---|---|
| PubChem CID | 163547039 |
| Molecular Formula | C21H35N3O8S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | (3-methylsulfonyl-2,5-dioxopyrrolidin-1-yl) 12-acetamido-8-(dimethylamino)-7-oxododecanoate |
| SMILES | CC(=O)NCCCCC(C(=O)CCCCCC(=O)ON1C(=O)CC(S(C)(=O)=O)C1=O)N(C)C |
| InChI | InChI=1S/C21H35N3O8S/c1-15(25)22-13-9-8-10-16(23(2)3)17(26)11-6-5-7-12-20(28)32-24-19(27)14-18(21(24)29)33(4,30)31/h16,18H,5-14H2,1-4H3,(H,22,25) |
| InChIKey | ZLWVBIUYELVMTF-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 147.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|