C14H21N3O8S — CID 175647858
1-[6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]hexanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid (PubChem CID 175647858) has the molecular formula C14H21N3O8S and a molecular weight of 391.40 g/mol. Its IUPAC name is 1-[6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]hexanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid.
| Compound Name | 1-[6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]hexanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 175647858 |
| Molecular Formula | C14H21N3O8S |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 1-[6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]hexanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
| SMILES | C[C@@H]1NC(=O)N[C@@H]1CCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C14H21N3O8S/c1-8-9(16-14(21)15-8)5-3-2-4-6-12(19)25-17-11(18)7-10(13(17)20)26(22,23)24/h8-10H,2-7H2,1H3,(H2,15,16,21)(H,22,23,24)/t8-,9+,10?/m0/s1 |
| InChIKey | RQXSLZYAWWMBHU-QIIDTADFSA-N |
| XLogP | -0.52 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|