C20H32N4O6 — CID 101206729
(2,5-dioxopyrrolidin-1-yl) 6-[6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]hexanoylamino]hexanoate (PubChem CID 101206729) has the molecular formula C20H32N4O6 and a molecular weight of 424.50 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]hexanoylamino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]hexanoylamino]hexanoate |
|---|---|
| PubChem CID | 101206729 |
| Molecular Formula | C20H32N4O6 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]hexanoylamino]hexanoate |
| SMILES | C[C@@H]1NC(=O)N[C@@H]1CCCCCC(=O)NCCCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C20H32N4O6/c1-14-15(23-20(29)22-14)8-4-2-5-9-16(25)21-13-7-3-6-10-19(28)30-24-17(26)11-12-18(24)27/h14-15H,2-13H2,1H3,(H,21,25)(H2,22,23,29)/t14-,15+/m0/s1 |
| InChIKey | UPLIODHTSQTWKI-LSDHHAIUSA-N |
| XLogP | 1.29 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|