C17H31N3O3S — CID 87756990
methyl 6-[6-[(4R,5S)-5-methyl-2-sulfanylideneimidazolidin-4-yl]hexanoylamino]hexanoate (PubChem CID 87756990) has the molecular formula C17H31N3O3S and a molecular weight of 357.52 g/mol. Its IUPAC name is methyl 6-[6-[(4R,5S)-5-methyl-2-sulfanylideneimidazolidin-4-yl]hexanoylamino]hexanoate.
| Compound Name | methyl 6-[6-[(4R,5S)-5-methyl-2-sulfanylideneimidazolidin-4-yl]hexanoylamino]hexanoate |
|---|---|
| PubChem CID | 87756990 |
| Molecular Formula | C17H31N3O3S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | methyl 6-[6-[(4R,5S)-5-methyl-2-sulfanylideneimidazolidin-4-yl]hexanoylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)CCCCC[C@H]1NC(=S)N[C@H]1C |
| InChI | InChI=1S/C17H31N3O3S/c1-13-14(20-17(24)19-13)9-5-3-6-10-15(21)18-12-8-4-7-11-16(22)23-2/h13-14H,3-12H2,1-2H3,(H,18,21)(H2,19,20,24)/t13-,14+/m0/s1 |
| InChIKey | VEIXEFICSWGVJV-UONOGXRCSA-N |
| XLogP | 2.02 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|