C16H27N3O2 — CID 131983512
N-hex-4-ynyl-6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]hexanamide (PubChem CID 131983512) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is N-hex-4-ynyl-6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]hexanamide.
| Compound Name | N-hex-4-ynyl-6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]hexanamide |
|---|---|
| PubChem CID | 131983512 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | N-hex-4-ynyl-6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]hexanamide |
| SMILES | CC#CCCCNC(=O)CCCCC[C@H]1NC(=O)N[C@H]1C |
| InChI | InChI=1S/C16H27N3O2/c1-3-4-5-9-12-17-15(20)11-8-6-7-10-14-13(2)18-16(21)19-14/h13-14H,5-12H2,1-2H3,(H,17,20)(H2,18,19,21)/t13-,14+/m0/s1 |
| InChIKey | AJWICRIQOBCXPG-UONOGXRCSA-N |
| XLogP | 1.93 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|