C16H32N4O4 — CID 91759535
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]hexanamide (PubChem CID 91759535) has the molecular formula C16H32N4O4 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]hexanamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]hexanamide |
|---|---|
| PubChem CID | 91759535 |
| Molecular Formula | C16H32N4O4 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]hexanamide |
| SMILES | C[C@@H]1NC(=O)N[C@@H]1CCCCCC(=O)NCCOCCOCCN |
| InChI | InChI=1S/C16H32N4O4/c1-13-14(20-16(22)19-13)5-3-2-4-6-15(21)18-8-10-24-12-11-23-9-7-17/h13-14H,2-12,17H2,1H3,(H,18,21)(H2,19,20,22)/t13-,14+/m0/s1 |
| InChIKey | JMZMBLMMFCKEDJ-UONOGXRCSA-N |
| XLogP | 0.11 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|