5-[(4S,5S)-5-methyl-2-oxoimidazolidin-4-yl]pentanoic acid

C9H16N2O3 — CID 2054868

IUPAC5-[(4S,5S)-5-methyl-2-oxoimidazolidin-4-yl]pentanoic acid
SMILESC[C@@H]1NC(=O)N[C@H]1CCCCC(=O)O
InChIInChI=1S/C9H16N2O3/c1-6-7(11-9(14)10-6)4-2-3-5-8(12)13/h6-7H,2-5H2,1H3,(H,12,13)(H2,10,11,14)/t6-,7-/m0/s1
InChIKeyBMKOIKZGCPRUSI-BQBZGAKWSA-N
MW200.24 g/mol
LogP0.70
Rot. Bonds5

About 5-[(4S,5S)-5-methyl-2-oxoimidazolidin-4-yl]pentanoic acid

5-[(4S,5S)-5-methyl-2-oxoimidazolidin-4-yl]pentanoic acid (PubChem CID 2054868) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 5-[(4S,5S)-5-methyl-2-oxoimidazolidin-4-yl]pentanoic acid.

Molecular Properties

Compound Name5-[(4S,5S)-5-methyl-2-oxoimidazolidin-4-yl]pentanoic acid
PubChem CID2054868
Molecular FormulaC9H16N2O3
Molecular Weight200.24 g/mol
Exact Mass200.12
IUPAC Name5-[(4S,5S)-5-methyl-2-oxoimidazolidin-4-yl]pentanoic acid
SMILESC[C@@H]1NC(=O)N[C@H]1CCCCC(=O)O
InChIInChI=1S/C9H16N2O3/c1-6-7(11-9(14)10-6)4-2-3-5-8(12)13/h6-7H,2-5H2,1H3,(H,12,13)(H2,10,11,14)/t6-,7-/m0/s1
InChIKeyBMKOIKZGCPRUSI-BQBZGAKWSA-N
XLogP0.70
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.24
LogP ≤ 50.70
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-[(4S,5S)-5-methyl-2-oxoimidazolidin-4-yl]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(4S,5S)-5-methyl-2-oxoimidazolidin-4-yl]pentanoic acid?
The IUPAC name of 5-[(4S,5S)-5-methyl-2-oxoimidazolidin-4-yl]pentanoic acid (CID 2054868) is 5-[(4S,5S)-5-methyl-2-oxoimidazolidin-4-yl]pentanoic acid.
What is the SMILES notation for 5-[(4S,5S)-5-methyl-2-oxoimidazolidin-4-yl]pentanoic acid?
The canonical SMILES for 5-[(4S,5S)-5-methyl-2-oxoimidazolidin-4-yl]pentanoic acid is C[C@@H]1NC(=O)N[C@H]1CCCCC(=O)O.
What is the InChIKey of 5-[(4S,5S)-5-methyl-2-oxoimidazolidin-4-yl]pentanoic acid?
The InChIKey is BMKOIKZGCPRUSI-BQBZGAKWSA-N. The full InChI is InChI=1S/C9H16N2O3/c1-6-7(11-9(14)10-6)4-2-3-5-8(12)13/h6-7H,2-5H2,1H3,(H,12,13)(H2,10,11,14)/t6-,7-/m0/s1.
What are the key properties of 5-[(4S,5S)-5-methyl-2-oxoimidazolidin-4-yl]pentanoic acid?
5-[(4S,5S)-5-methyl-2-oxoimidazolidin-4-yl]pentanoic acid has a molecular weight of 200.24 g/mol, XLogP of 0.70, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4S,5S)-5-methyl-2-oxoimidazolidin-4-yl]pentanoic acid is sourced from PubChem (CID 2054868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).