C15H21N2O2 — CID 73212702
CID 73212702 (PubChem CID 73212702) has the molecular formula C15H21N2O2 and a molecular weight of 261.34 g/mol.
| Compound Name | CID 73212702 |
|---|---|
| PubChem CID | 73212702 |
| Molecular Formula | C15H21N2O2 |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | — |
| SMILES | C[C@@H]1NC(=O)N[C@@H]1CCCCCC(=O)[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C15H21N2O2/c1-11-13(17-15(19)16-11)9-3-2-4-10-14(18)12-7-5-6-8-12/h5-8,11,13H,2-4,9-10H2,1H3,(H2,16,17,19)/t11-,13+/m0/s1 |
| InChIKey | UAUVRMOXKRPKHD-WCQYABFASA-N |
| XLogP | 1.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|