C18H24N2O17S2 — CID 146633111
1-[3-[2-[2-[3-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]propanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid (PubChem CID 146633111) has the molecular formula C18H24N2O17S2 and a molecular weight of 604.52 g/mol. Its IUPAC name is 1-[3-[2-[2-[3-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]propanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid.
| Compound Name | 1-[3-[2-[2-[3-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]propanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 146633111 |
| Molecular Formula | C18H24N2O17S2 |
| Molecular Weight | 604.52 g/mol |
| Exact Mass | 604.05 |
| IUPAC Name | 1-[3-[2-[2-[3-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]propanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
| SMILES | O=C(CCOCCOCCOCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C18H24N2O17S2/c21-13-9-11(38(27,28)29)17(25)19(13)36-15(23)1-3-33-5-7-35-8-6-34-4-2-16(24)37-20-14(22)10-12(18(20)26)39(30,31)32/h11-12H,1-10H2,(H,27,28,29)(H,30,31,32) |
| InChIKey | XALCMVILISIJJA-UHFFFAOYSA-N |
| XLogP | -3.24 |
| TPSA | 263.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.52 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|