About CID 175816716
CID 175816716 (PubChem CID 175816716) has the molecular formula C10H8N2NaO14S2
and a molecular weight of 467.30 g/mol.
Molecular Properties
| Compound Name | CID 175816716 |
| PubChem CID | 175816716 |
| Molecular Formula | C10H8N2NaO14S2 |
| Molecular Weight | 467.30 g/mol |
| Exact Mass | 466.93 |
| IUPAC Name | — |
| SMILES | O=C(ON1C(=O)CC(S(=O)(=O)O)C1=O)C(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na] |
| InChI | InChI=1S/C10H8N2O14S2.Na/c13-5-1-3(27(19,20)21)7(15)11(5)25-9(17)10(18)26-12-6(14)2-4(8(12)16)28(22,23)24;/h3-4H,1-2H2,(H,19,20,21)(H,22,23,24); |
| InChIKey | AXIJEVPLQBUHAM-UHFFFAOYSA-N |
| XLogP | -4.45 |
| TPSA | 236.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.30 |
| LogP ≤ 5 | -4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 175816716 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175816716?
The IUPAC name of CID 175816716 (CID 175816716) is not available.
What is the SMILES notation for CID 175816716?
The canonical SMILES for CID 175816716 is O=C(ON1C(=O)CC(S(=O)(=O)O)C1=O)C(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na].
What is the InChIKey of CID 175816716?
The InChIKey is AXIJEVPLQBUHAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O14S2.Na/c13-5-1-3(27(19,20)21)7(15)11(5)25-9(17)10(18)26-12-6(14)2-4(8(12)16)28(22,23)24;/h3-4H,1-2H2,(H,19,20,21)(H,22,23,24);.
What are the key properties of CID 175816716?
CID 175816716 has a molecular weight of 467.30 g/mol, XLogP of -4.45, 4 rotatable bonds, 2 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175816716 is sourced from PubChem (CID 175816716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).