C10H8N2NaO14S2 — CID 175816716
CID 175816716 (PubChem CID 175816716) has the molecular formula C10H8N2NaO14S2 and a molecular weight of 467.30 g/mol.
| Compound Name | CID 175816716 |
|---|---|
| PubChem CID | 175816716 |
| Molecular Formula | C10H8N2NaO14S2 |
| Molecular Weight | 467.30 g/mol |
| Exact Mass | 466.93 |
| IUPAC Name | — |
| SMILES | O=C(ON1C(=O)CC(S(=O)(=O)O)C1=O)C(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na] |
| InChI | InChI=1S/C10H8N2O14S2.Na/c13-5-1-3(27(19,20)21)7(15)11(5)25-9(17)10(18)26-12-6(14)2-4(8(12)16)28(22,23)24;/h3-4H,1-2H2,(H,19,20,21)(H,22,23,24); |
| InChIKey | AXIJEVPLQBUHAM-UHFFFAOYSA-N |
| XLogP | -4.45 |
| TPSA | 236.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.30 |
| LogP ≤ 5 | -4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|