C18H20N2O18S2 — CID 20695363
1-[4-[2-[4-[2,5-dioxo-3-(trioxidanylsulfanyl)pyrrolidin-1-yl]oxy-4-oxobutanoyl]oxyethoxy]-4-oxobutanoyl]oxy-2,5-dioxopyrrolidine-3-sulfonic acid (PubChem CID 20695363) has the molecular formula C18H20N2O18S2 and a molecular weight of 616.49 g/mol. Its IUPAC name is 1-[4-[2-[4-[2,5-dioxo-3-(trioxidanylsulfanyl)pyrrolidin-1-yl]oxy-4-oxobutanoyl]oxyethoxy]-4-oxobutanoyl]oxy-2,5-dioxopyrrolidine-3-sulfonic acid.
| Compound Name | 1-[4-[2-[4-[2,5-dioxo-3-(trioxidanylsulfanyl)pyrrolidin-1-yl]oxy-4-oxobutanoyl]oxyethoxy]-4-oxobutanoyl]oxy-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 20695363 |
| Molecular Formula | C18H20N2O18S2 |
| Molecular Weight | 616.49 g/mol |
| Exact Mass | 616.02 |
| IUPAC Name | 1-[4-[2-[4-[2,5-dioxo-3-(trioxidanylsulfanyl)pyrrolidin-1-yl]oxy-4-oxobutanoyl]oxyethoxy]-4-oxobutanoyl]oxy-2,5-dioxopyrrolidine-3-sulfonic acid |
| SMILES | O=C(CCC(=O)ON1C(=O)CC(SOOO)C1=O)OCCOC(=O)CCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C18H20N2O18S2/c21-11-7-9(39-38-37-29)17(27)19(11)35-15(25)3-1-13(23)33-5-6-34-14(24)2-4-16(26)36-20-12(22)8-10(18(20)28)40(30,31)32/h9-10,29H,1-8H2,(H,30,31,32) |
| InChIKey | BVCDPKMWGJPSAC-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 273.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.49 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|