C18H18N2Na2O18S2 — CID 20695362
disodium;1-[4-[2-[4-(3-oxidoperoxysulfanyl-2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutanoyl]oxyethoxy]-4-oxobutanoyl]oxy-2,5-dioxopyrrolidine-3-sulfonate (PubChem CID 20695362) has the molecular formula C18H18N2Na2O18S2 and a molecular weight of 660.45 g/mol. Its IUPAC name is disodium;1-[4-[2-[4-(3-oxidoperoxysulfanyl-2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutanoyl]oxyethoxy]-4-oxobutanoyl]oxy-2,5-dioxopyrrolidine-3-sulfonate.
| Compound Name | disodium;1-[4-[2-[4-(3-oxidoperoxysulfanyl-2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutanoyl]oxyethoxy]-4-oxobutanoyl]oxy-2,5-dioxopyrrolidine-3-sulfonate |
|---|---|
| PubChem CID | 20695362 |
| Molecular Formula | C18H18N2Na2O18S2 |
| Molecular Weight | 660.45 g/mol |
| Exact Mass | 659.98 |
| IUPAC Name | disodium;1-[4-[2-[4-(3-oxidoperoxysulfanyl-2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutanoyl]oxyethoxy]-4-oxobutanoyl]oxy-2,5-dioxopyrrolidine-3-sulfonate |
| SMILES | O=C(CCC(=O)ON1C(=O)CC(SOO[O-])C1=O)OCCOC(=O)CCC(=O)ON1C(=O)CC(S(=O)(=O)[O-])C1=O.[Na+].[Na+] |
| InChI | InChI=1S/C18H20N2O18S2.2Na/c21-11-7-9(39-38-37-29)17(27)19(11)35-15(25)3-1-13(23)33-5-6-34-14(24)2-4-16(26)36-20-12(22)8-10(18(20)28)40(30,31)32;;/h9-10,29H,1-8H2,(H,30,31,32);;/q;2*+1/p-2 |
| InChIKey | BLXRYNYMGXHCRA-UHFFFAOYSA-L |
| XLogP | -9.77 |
| TPSA | 278.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.45 |
| LogP ≤ 5 | -9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|