C13H12NNaO7S — CID 102472680
sodium 2,5-dioxo-1-(3-phenylpropanoyloxy)pyrrolidine-3-sulfonate (PubChem CID 102472680) has the molecular formula C13H12NNaO7S and a molecular weight of 349.30 g/mol. Its IUPAC name is sodium 2,5-dioxo-1-(3-phenylpropanoyloxy)pyrrolidine-3-sulfonate.
| Compound Name | sodium 2,5-dioxo-1-(3-phenylpropanoyloxy)pyrrolidine-3-sulfonate |
|---|---|
| PubChem CID | 102472680 |
| Molecular Formula | C13H12NNaO7S |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | sodium 2,5-dioxo-1-(3-phenylpropanoyloxy)pyrrolidine-3-sulfonate |
| SMILES | O=C(CCc1ccccc1)ON1C(=O)CC(S(=O)(=O)[O-])C1=O.[Na+] |
| InChI | InChI=1S/C13H13NO7S.Na/c15-11-8-10(22(18,19)20)13(17)14(11)21-12(16)7-6-9-4-2-1-3-5-9;/h1-5,10H,6-8H2,(H,18,19,20);/q;+1/p-1 |
| InChIKey | VGMWHKZYXBYTDD-UHFFFAOYSA-M |
| XLogP | -3.25 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|