C15H7F17NNaO7S — CID 23687360
sodium 1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoyloxy)-2,5-dioxopyrrolidine-3-sulfonate (PubChem CID 23687360) has the molecular formula C15H7F17NNaO7S and a molecular weight of 691.24 g/mol. Its IUPAC name is sodium 1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoyloxy)-2,5-dioxopyrrolidine-3-sulfonate.
| Compound Name | sodium 1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoyloxy)-2,5-dioxopyrrolidine-3-sulfonate |
|---|---|
| PubChem CID | 23687360 |
| Molecular Formula | C15H7F17NNaO7S |
| Molecular Weight | 691.24 g/mol |
| Exact Mass | 690.96 |
| IUPAC Name | sodium 1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoyloxy)-2,5-dioxopyrrolidine-3-sulfonate |
| SMILES | O=C(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ON1C(=O)CC(S(=O)(=O)[O-])C1=O.[Na+] |
| InChI | InChI=1S/C15H8F17NO7S.Na/c16-8(17,2-1-6(35)40-33-5(34)3-4(7(33)36)41(37,38)39)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)14(28,29)15(30,31)32;/h4H,1-3H2,(H,37,38,39);/q;+1/p-1 |
| InChIKey | BUTZTAYUHZBBKU-UHFFFAOYSA-M |
| XLogP | 0.91 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.24 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|