C7H8NO7S- — CID 23591794
2,5-dioxo-1-propanoyloxypyrrolidine-3-sulfonate (PubChem CID 23591794) has the molecular formula C7H8NO7S- and a molecular weight of 250.21 g/mol. Its IUPAC name is 2,5-dioxo-1-propanoyloxypyrrolidine-3-sulfonate.
| Compound Name | 2,5-dioxo-1-propanoyloxypyrrolidine-3-sulfonate |
|---|---|
| PubChem CID | 23591794 |
| Molecular Formula | C7H8NO7S- |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 2,5-dioxo-1-propanoyloxypyrrolidine-3-sulfonate |
| SMILES | CCC(=O)ON1C(=O)CC(S(=O)(=O)[O-])C1=O |
| InChI | InChI=1S/C7H9NO7S/c1-2-6(10)15-8-5(9)3-4(7(8)11)16(12,13)14/h4H,2-3H2,1H3,(H,12,13,14)/p-1 |
| InChIKey | YYDMSFVTLYEPOH-UHFFFAOYSA-M |
| XLogP | -1.47 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|