C28H26NNaO8S3 — CID 25178438
sodium 1-[3-[4-[hydroxy-bis(4-methylsulfanylphenyl)methyl]phenyl]propanoyloxy]-2,5-dioxopyrrolidine-3-sulfonate (PubChem CID 25178438) has the molecular formula C28H26NNaO8S3 and a molecular weight of 623.71 g/mol. Its IUPAC name is sodium 1-[3-[4-[hydroxy-bis(4-methylsulfanylphenyl)methyl]phenyl]propanoyloxy]-2,5-dioxopyrrolidine-3-sulfonate.
| Compound Name | sodium 1-[3-[4-[hydroxy-bis(4-methylsulfanylphenyl)methyl]phenyl]propanoyloxy]-2,5-dioxopyrrolidine-3-sulfonate |
|---|---|
| PubChem CID | 25178438 |
| Molecular Formula | C28H26NNaO8S3 |
| Molecular Weight | 623.71 g/mol |
| Exact Mass | 623.07 |
| IUPAC Name | sodium 1-[3-[4-[hydroxy-bis(4-methylsulfanylphenyl)methyl]phenyl]propanoyloxy]-2,5-dioxopyrrolidine-3-sulfonate |
| SMILES | CSc1ccc(C(O)(c2ccc(CCC(=O)ON3C(=O)CC(S(=O)(=O)[O-])C3=O)cc2)c2ccc(SC)cc2)cc1.[Na+] |
| InChI | InChI=1S/C28H27NO8S3.Na/c1-38-22-12-8-20(9-13-22)28(33,21-10-14-23(39-2)15-11-21)19-6-3-18(4-7-19)5-16-26(31)37-29-25(30)17-24(27(29)32)40(34,35)36;/h3-4,6-15,24,33H,5,16-17H2,1-2H3,(H,34,35,36);/q;+1/p-1 |
| InChIKey | WWLFTEGHNNGZJI-UHFFFAOYSA-M |
| XLogP | 0.48 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.71 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|