C29H29NO11S — CID 25180752
1-[4-[4-[hydroxy-bis(4-methoxyphenyl)methyl]phenoxy]butanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid (PubChem CID 25180752) has the molecular formula C29H29NO11S and a molecular weight of 599.61 g/mol. Its IUPAC name is 1-[4-[4-[hydroxy-bis(4-methoxyphenyl)methyl]phenoxy]butanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid.
| Compound Name | 1-[4-[4-[hydroxy-bis(4-methoxyphenyl)methyl]phenoxy]butanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 25180752 |
| Molecular Formula | C29H29NO11S |
| Molecular Weight | 599.61 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | 1-[4-[4-[hydroxy-bis(4-methoxyphenyl)methyl]phenoxy]butanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
| SMILES | COc1ccc(C(O)(c2ccc(OC)cc2)c2ccc(OCCCC(=O)ON3C(=O)CC(S(=O)(=O)O)C3=O)cc2)cc1 |
| InChI | InChI=1S/C29H29NO11S/c1-38-22-11-5-19(6-12-22)29(34,20-7-13-23(39-2)14-8-20)21-9-15-24(16-10-21)40-17-3-4-27(32)41-30-26(31)18-25(28(30)33)42(35,36)37/h5-16,25,34H,3-4,17-18H2,1-2H3,(H,35,36,37) |
| InChIKey | DBSNLTVRASXIGY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 165.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.61 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|