C36H36N2O12 — CID 23069524
(2,5-dioxopyrrolidin-1-yl) 4-[4-[[4-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutoxy]phenyl]-hydroxy-(4-methoxyphenyl)methyl]phenoxy]butanoate (PubChem CID 23069524) has the molecular formula C36H36N2O12 and a molecular weight of 688.69 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[4-[[4-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutoxy]phenyl]-hydroxy-(4-methoxyphenyl)methyl]phenoxy]butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[4-[[4-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutoxy]phenyl]-hydroxy-(4-methoxyphenyl)methyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 23069524 |
| Molecular Formula | C36H36N2O12 |
| Molecular Weight | 688.69 g/mol |
| Exact Mass | 688.23 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[4-[[4-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutoxy]phenyl]-hydroxy-(4-methoxyphenyl)methyl]phenoxy]butanoate |
| SMILES | COc1ccc(C(O)(c2ccc(OCCCC(=O)ON3C(=O)CCC3=O)cc2)c2ccc(OCCCC(=O)ON3C(=O)CCC3=O)cc2)cc1 |
| InChI | InChI=1S/C36H36N2O12/c1-46-27-12-6-24(7-13-27)36(45,25-8-14-28(15-9-25)47-22-2-4-34(43)49-37-30(39)18-19-31(37)40)26-10-16-29(17-11-26)48-23-3-5-35(44)50-38-32(41)20-21-33(38)42/h6-17,45H,2-5,18-23H2,1H3 |
| InChIKey | IOSCGZZFTKBLGW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 175.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.69 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|