C28H33NO5 — CID 22886581
6-[4-[hydroxy-bis(4-methoxyphenyl)methyl]phenoxy]-N-methylhexanamide (PubChem CID 22886581) has the molecular formula C28H33NO5 and a molecular weight of 463.57 g/mol. Its IUPAC name is 6-[4-[hydroxy-bis(4-methoxyphenyl)methyl]phenoxy]-N-methylhexanamide.
| Compound Name | 6-[4-[hydroxy-bis(4-methoxyphenyl)methyl]phenoxy]-N-methylhexanamide |
|---|---|
| PubChem CID | 22886581 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 6-[4-[hydroxy-bis(4-methoxyphenyl)methyl]phenoxy]-N-methylhexanamide |
| SMILES | CNC(=O)CCCCCOc1ccc(C(O)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H33NO5/c1-29-27(30)7-5-4-6-20-34-26-18-12-23(13-19-26)28(31,21-8-14-24(32-2)15-9-21)22-10-16-25(33-3)17-11-22/h8-19,31H,4-7,20H2,1-3H3,(H,29,30) |
| InChIKey | WUDWHMLDMODLCF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|