C23H33NO9 — CID 101425925
4-(2-carboxyethyl)-4-[6-(4-methoxyphenoxy)hexanoylamino]heptanedioic acid (PubChem CID 101425925) has the molecular formula C23H33NO9 and a molecular weight of 467.52 g/mol. Its IUPAC name is 4-(2-carboxyethyl)-4-[6-(4-methoxyphenoxy)hexanoylamino]heptanedioic acid.
| Compound Name | 4-(2-carboxyethyl)-4-[6-(4-methoxyphenoxy)hexanoylamino]heptanedioic acid |
|---|---|
| PubChem CID | 101425925 |
| Molecular Formula | C23H33NO9 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 4-(2-carboxyethyl)-4-[6-(4-methoxyphenoxy)hexanoylamino]heptanedioic acid |
| SMILES | COc1ccc(OCCCCCC(=O)NC(CCC(=O)O)(CCC(=O)O)CCC(=O)O)cc1 |
| InChI | InChI=1S/C23H33NO9/c1-32-17-6-8-18(9-7-17)33-16-4-2-3-5-19(25)24-23(13-10-20(26)27,14-11-21(28)29)15-12-22(30)31/h6-9H,2-5,10-16H2,1H3,(H,24,25)(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | VCFANIVFWLGHGM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 159.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|