C13H19NO3 — CID 21173657
N-ethyl-4-(4-methoxyphenoxy)butanamide (PubChem CID 21173657) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is N-ethyl-4-(4-methoxyphenoxy)butanamide.
| Compound Name | N-ethyl-4-(4-methoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 21173657 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | N-ethyl-4-(4-methoxyphenoxy)butanamide |
| SMILES | CCNC(=O)CCCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C13H19NO3/c1-3-14-13(15)5-4-10-17-12-8-6-11(16-2)7-9-12/h6-9H,3-5,10H2,1-2H3,(H,14,15) |
| InChIKey | WIXICZOCKJUWGM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|