C15H25ClN2O3 — CID 119747931
N-[3-(4-methoxyphenoxy)propyl]-4-(methylamino)butanamide;hydrochloride (PubChem CID 119747931) has the molecular formula C15H25ClN2O3 and a molecular weight of 316.83 g/mol. Its IUPAC name is N-[3-(4-methoxyphenoxy)propyl]-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-[3-(4-methoxyphenoxy)propyl]-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119747931 |
| Molecular Formula | C15H25ClN2O3 |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | N-[3-(4-methoxyphenoxy)propyl]-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)NCCCOc1ccc(OC)cc1.Cl |
| InChI | InChI=1S/C15H24N2O3.ClH/c1-16-10-3-5-15(18)17-11-4-12-20-14-8-6-13(19-2)7-9-14;/h6-9,16H,3-5,10-12H2,1-2H3,(H,17,18);1H |
| InChIKey | LNRYRKDDYSAWDZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|