C15H25ClN2O4 — CID 119822601
N-[2-(3,5-dimethoxyphenoxy)ethyl]-4-(methylamino)butanamide;hydrochloride (PubChem CID 119822601) has the molecular formula C15H25ClN2O4 and a molecular weight of 332.83 g/mol. Its IUPAC name is N-[2-(3,5-dimethoxyphenoxy)ethyl]-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-[2-(3,5-dimethoxyphenoxy)ethyl]-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119822601 |
| Molecular Formula | C15H25ClN2O4 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-[2-(3,5-dimethoxyphenoxy)ethyl]-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)NCCOc1cc(OC)cc(OC)c1.Cl |
| InChI | InChI=1S/C15H24N2O4.ClH/c1-16-6-4-5-15(18)17-7-8-21-14-10-12(19-2)9-13(11-14)20-3;/h9-11,16H,4-8H2,1-3H3,(H,17,18);1H |
| InChIKey | BTUBAQANFSKPAX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|