C13H21ClN2O4 — CID 119344811
2-amino-N-[3-(3,5-dimethoxyphenoxy)propyl]acetamide;hydrochloride (PubChem CID 119344811) has the molecular formula C13H21ClN2O4 and a molecular weight of 304.77 g/mol. Its IUPAC name is 2-amino-N-[3-(3,5-dimethoxyphenoxy)propyl]acetamide;hydrochloride.
| Compound Name | 2-amino-N-[3-(3,5-dimethoxyphenoxy)propyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119344811 |
| Molecular Formula | C13H21ClN2O4 |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-amino-N-[3-(3,5-dimethoxyphenoxy)propyl]acetamide;hydrochloride |
| SMILES | COc1cc(OC)cc(OCCCNC(=O)CN)c1.Cl |
| InChI | InChI=1S/C13H20N2O4.ClH/c1-17-10-6-11(18-2)8-12(7-10)19-5-3-4-15-13(16)9-14;/h6-8H,3-5,9,14H2,1-2H3,(H,15,16);1H |
| InChIKey | RFUFBNWTFCHNMP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|