C14H22N2O5 — CID 120992852
2-amino-N-[2-(3,5-dimethoxyphenoxy)ethyl]-3-methoxypropanamide (PubChem CID 120992852) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-amino-N-[2-(3,5-dimethoxyphenoxy)ethyl]-3-methoxypropanamide.
| Compound Name | 2-amino-N-[2-(3,5-dimethoxyphenoxy)ethyl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 120992852 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-amino-N-[2-(3,5-dimethoxyphenoxy)ethyl]-3-methoxypropanamide |
| SMILES | COCC(N)C(=O)NCCOc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C14H22N2O5/c1-18-9-13(15)14(17)16-4-5-21-12-7-10(19-2)6-11(8-12)20-3/h6-8,13H,4-5,9,15H2,1-3H3,(H,16,17) |
| InChIKey | GWFPEDMTJWJJKL-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|