C12H15Cl3N2O3 — CID 120991939
2-amino-3-methoxy-N-[2-(2,4,6-trichlorophenoxy)ethyl]propanamide (PubChem CID 120991939) has the molecular formula C12H15Cl3N2O3 and a molecular weight of 341.62 g/mol. Its IUPAC name is 2-amino-3-methoxy-N-[2-(2,4,6-trichlorophenoxy)ethyl]propanamide.
| Compound Name | 2-amino-3-methoxy-N-[2-(2,4,6-trichlorophenoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 120991939 |
| Molecular Formula | C12H15Cl3N2O3 |
| Molecular Weight | 341.62 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 2-amino-3-methoxy-N-[2-(2,4,6-trichlorophenoxy)ethyl]propanamide |
| SMILES | COCC(N)C(=O)NCCOc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C12H15Cl3N2O3/c1-19-6-10(16)12(18)17-2-3-20-11-8(14)4-7(13)5-9(11)15/h4-5,10H,2-3,6,16H2,1H3,(H,17,18) |
| InChIKey | TVAPJXXGKGHRFZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.62 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|