C16H23Cl3N4O3 — CID 110043283
2-[[(2-methoxyethylamino)-[2-(2,4,6-trichlorophenoxy)ethylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110043283) has the molecular formula C16H23Cl3N4O3 and a molecular weight of 425.74 g/mol. Its IUPAC name is 2-[[(2-methoxyethylamino)-[2-(2,4,6-trichlorophenoxy)ethylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(2-methoxyethylamino)-[2-(2,4,6-trichlorophenoxy)ethylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110043283 |
| Molecular Formula | C16H23Cl3N4O3 |
| Molecular Weight | 425.74 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 2-[[(2-methoxyethylamino)-[2-(2,4,6-trichlorophenoxy)ethylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | COCCN/C(=N\CC(=O)N(C)C)NCCOc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C16H23Cl3N4O3/c1-23(2)14(24)10-22-16(20-4-6-25-3)21-5-7-26-15-12(18)8-11(17)9-13(15)19/h8-9H,4-7,10H2,1-3H3,(H2,20,21,22) |
| InChIKey | AONOKTWDCIQXIG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.74 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|