C16H24Cl3IN4O2 — CID 109464207
3-[[ethylamino-[2-(2,4,6-trichlorophenoxy)ethylamino]methylidene]amino]-N,N-dimethylpropanamide;hydroiodide (PubChem CID 109464207) has the molecular formula C16H24Cl3IN4O2 and a molecular weight of 537.66 g/mol. Its IUPAC name is 3-[[ethylamino-[2-(2,4,6-trichlorophenoxy)ethylamino]methylidene]amino]-N,N-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[ethylamino-[2-(2,4,6-trichlorophenoxy)ethylamino]methylidene]amino]-N,N-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 109464207 |
| Molecular Formula | C16H24Cl3IN4O2 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 536.00 |
| IUPAC Name | 3-[[ethylamino-[2-(2,4,6-trichlorophenoxy)ethylamino]methylidene]amino]-N,N-dimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)N(C)C)NCCOc1c(Cl)cc(Cl)cc1Cl.I |
| InChI | InChI=1S/C16H23Cl3N4O2.HI/c1-4-20-16(21-6-5-14(24)23(2)3)22-7-8-25-15-12(18)9-11(17)10-13(15)19;/h9-10H,4-8H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | XJYUOGVQFIKHJV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|