C18H27ClF3N5O2 — CID 111667142
3-[[[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethylamino]-(ethylamino)methylidene]amino]-N,N-diethylpropanamide (PubChem CID 111667142) has the molecular formula C18H27ClF3N5O2 and a molecular weight of 437.89 g/mol. Its IUPAC name is 3-[[[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethylamino]-(ethylamino)methylidene]amino]-N,N-diethylpropanamide.
| Compound Name | 3-[[[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethylamino]-(ethylamino)methylidene]amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 111667142 |
| Molecular Formula | C18H27ClF3N5O2 |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 3-[[[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethylamino]-(ethylamino)methylidene]amino]-N,N-diethylpropanamide |
| SMILES | CCN/C(=N\CCC(=O)N(CC)CC)NCCOc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C18H27ClF3N5O2/c1-4-23-17(24-8-7-15(28)27(5-2)6-3)25-9-10-29-16-14(19)11-13(12-26-16)18(20,21)22/h11-12H,4-10H2,1-3H3,(H2,23,24,25) |
| InChIKey | MRGOWDUJYGFACS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|