C14H17ClF3IN4O — CID 136926869
2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1-ethyl-3-prop-2-ynylguanidine;hydroiodide (PubChem CID 136926869) has the molecular formula C14H17ClF3IN4O and a molecular weight of 476.67 g/mol. Its IUPAC name is 2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1-ethyl-3-prop-2-ynylguanidine;hydroiodide.
| Compound Name | 2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1-ethyl-3-prop-2-ynylguanidine;hydroiodide |
|---|---|
| PubChem CID | 136926869 |
| Molecular Formula | C14H17ClF3IN4O |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | 2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1-ethyl-3-prop-2-ynylguanidine;hydroiodide |
| SMILES | C#CCN/C(=N/CCOc1ncc(C(F)(F)F)cc1Cl)NCC.I |
| InChI | InChI=1S/C14H16ClF3N4O.HI/c1-3-5-20-13(19-4-2)21-6-7-23-12-11(15)8-10(9-22-12)14(16,17)18;/h1,8-9H,4-7H2,2H3,(H2,19,20,21);1H |
| InChIKey | ZULRZYWTHBIOCV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|