C16H17ClF3IN4O — CID 111819421
2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1-(4-methylphenyl)guanidine;hydroiodide (PubChem CID 111819421) has the molecular formula C16H17ClF3IN4O and a molecular weight of 500.69 g/mol. Its IUPAC name is 2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1-(4-methylphenyl)guanidine;hydroiodide.
| Compound Name | 2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1-(4-methylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111819421 |
| Molecular Formula | C16H17ClF3IN4O |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.01 |
| IUPAC Name | 2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1-(4-methylphenyl)guanidine;hydroiodide |
| SMILES | Cc1ccc(N/C(N)=N/CCOc2ncc(C(F)(F)F)cc2Cl)cc1.I |
| InChI | InChI=1S/C16H16ClF3N4O.HI/c1-10-2-4-12(5-3-10)24-15(21)22-6-7-25-14-13(17)8-11(9-23-14)16(18,19)20;/h2-5,8-9H,6-7H2,1H3,(H3,21,22,24);1H |
| InChIKey | FOVDRXLNBUUVNE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|