C16H19ClF3IN6OS — CID 111819447
N'-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111819447) has the molecular formula C16H19ClF3IN6OS and a molecular weight of 562.79 g/mol. Its IUPAC name is N'-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111819447 |
| Molecular Formula | C16H19ClF3IN6OS |
| Molecular Weight | 562.79 g/mol |
| Exact Mass | 562.00 |
| IUPAC Name | N'-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCOc1ncc(C(F)(F)F)cc1Cl)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C16H18ClF3N6OS.HI/c17-12-9-11(16(18,19)20)10-24-13(12)27-7-1-22-14(21)25-3-5-26(6-4-25)15-23-2-8-28-15;/h2,8-10H,1,3-7H2,(H2,21,22);1H |
| InChIKey | LFNCRLATFPUHPN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.79 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|