C14H19ClIN5S2 — CID 111072326
N'-[2-(5-chlorothiophen-2-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111072326) has the molecular formula C14H19ClIN5S2 and a molecular weight of 483.83 g/mol. Its IUPAC name is N'-[2-(5-chlorothiophen-2-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(5-chlorothiophen-2-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111072326 |
| Molecular Formula | C14H19ClIN5S2 |
| Molecular Weight | 483.83 g/mol |
| Exact Mass | 482.98 |
| IUPAC Name | N'-[2-(5-chlorothiophen-2-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCc1ccc(Cl)s1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C14H18ClN5S2.HI/c15-12-2-1-11(22-12)3-4-17-13(16)19-6-8-20(9-7-19)14-18-5-10-21-14;/h1-2,5,10H,3-4,6-9H2,(H2,16,17);1H |
| InChIKey | QQJYDLNNLHTFJZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 57.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.83 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|