C14H21N7S — CID 110050271
N'-[2-(2-methylpyrazol-3-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 110050271) has the molecular formula C14H21N7S and a molecular weight of 319.44 g/mol. Its IUPAC name is N'-[2-(2-methylpyrazol-3-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[2-(2-methylpyrazol-3-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110050271 |
| Molecular Formula | C14H21N7S |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N'-[2-(2-methylpyrazol-3-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | Cn1nccc1CC/N=C(\N)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C14H21N7S/c1-19-12(3-5-18-19)2-4-16-13(15)20-7-9-21(10-8-20)14-17-6-11-22-14/h3,5-6,11H,2,4,7-10H2,1H3,(H2,15,16) |
| InChIKey | CYKXYEQFMUOJTC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 75.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|