C17H21N5O3S — CID 111072065
N'-[2-(1,3-benzodioxol-5-yloxy)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111072065) has the molecular formula C17H21N5O3S and a molecular weight of 375.45 g/mol. Its IUPAC name is N'-[2-(1,3-benzodioxol-5-yloxy)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[2-(1,3-benzodioxol-5-yloxy)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111072065 |
| Molecular Formula | C17H21N5O3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N'-[2-(1,3-benzodioxol-5-yloxy)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\CCOc1ccc2c(c1)OCO2)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C17H21N5O3S/c18-16(21-5-7-22(8-6-21)17-20-4-10-26-17)19-3-9-23-13-1-2-14-15(11-13)25-12-24-14/h1-2,4,10-11H,3,5-9,12H2,(H2,18,19) |
| InChIKey | YPYPPHOZYCKWMB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|