C15H21N3O3 — CID 111072067
N'-[2-(1,3-benzodioxol-5-yloxy)ethyl]piperidine-1-carboximidamide (PubChem CID 111072067) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is N'-[2-(1,3-benzodioxol-5-yloxy)ethyl]piperidine-1-carboximidamide.
| Compound Name | N'-[2-(1,3-benzodioxol-5-yloxy)ethyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111072067 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N'-[2-(1,3-benzodioxol-5-yloxy)ethyl]piperidine-1-carboximidamide |
| SMILES | N/C(=N\CCOc1ccc2c(c1)OCO2)N1CCCCC1 |
| InChI | InChI=1S/C15H21N3O3/c16-15(18-7-2-1-3-8-18)17-6-9-19-12-4-5-13-14(10-12)21-11-20-13/h4-5,10H,1-3,6-9,11H2,(H2,16,17) |
| InChIKey | HXSGUGVLLVCYJP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|