C15H22ClN5O2 — CID 161285939
N'-[N'-(1,3-benzodioxol-5-ylmethyl)carbamimidoyl]piperidine-1-carboximidamide;hydrochloride (PubChem CID 161285939) has the molecular formula C15H22ClN5O2 and a molecular weight of 339.83 g/mol. Its IUPAC name is N'-[N'-(1,3-benzodioxol-5-ylmethyl)carbamimidoyl]piperidine-1-carboximidamide;hydrochloride.
| Compound Name | N'-[N'-(1,3-benzodioxol-5-ylmethyl)carbamimidoyl]piperidine-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 161285939 |
| Molecular Formula | C15H22ClN5O2 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N'-[N'-(1,3-benzodioxol-5-ylmethyl)carbamimidoyl]piperidine-1-carboximidamide;hydrochloride |
| SMILES | Cl.NC(=N/C(N)=N/Cc1ccc2c(c1)OCO2)N1CCCCC1 |
| InChI | InChI=1S/C15H21N5O2.ClH/c16-14(19-15(17)20-6-2-1-3-7-20)18-9-11-4-5-12-13(8-11)22-10-21-12;/h4-5,8H,1-3,6-7,9-10H2,(H4,16,17,18,19);1H |
| InChIKey | KLEDPYCAUKDFGC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|