C14H19Cl2N5 — CID 142720621
N'-[N'-[(3,4-dichlorophenyl)methyl]carbamimidoyl]piperidine-1-carboximidamide (PubChem CID 142720621) has the molecular formula C14H19Cl2N5 and a molecular weight of 328.25 g/mol. Its IUPAC name is N'-[N'-[(3,4-dichlorophenyl)methyl]carbamimidoyl]piperidine-1-carboximidamide.
| Compound Name | N'-[N'-[(3,4-dichlorophenyl)methyl]carbamimidoyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 142720621 |
| Molecular Formula | C14H19Cl2N5 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N'-[N'-[(3,4-dichlorophenyl)methyl]carbamimidoyl]piperidine-1-carboximidamide |
| SMILES | N/C(=N/C(N)=N/Cc1ccc(Cl)c(Cl)c1)N1CCCCC1 |
| InChI | InChI=1S/C14H19Cl2N5/c15-11-5-4-10(8-12(11)16)9-19-13(17)20-14(18)21-6-2-1-3-7-21/h4-5,8H,1-3,6-7,9H2,(H4,17,18,19,20) |
| InChIKey | SETWRYGAAGDOAA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|