C12H18ClIN4 — CID 111041986
N'-[(6-chloro-3-pyridinyl)methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111041986) has the molecular formula C12H18ClIN4 and a molecular weight of 380.66 g/mol. Its IUPAC name is N'-[(6-chloro-3-pyridinyl)methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(6-chloro-3-pyridinyl)methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111041986 |
| Molecular Formula | C12H18ClIN4 |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | N'-[(6-chloro-3-pyridinyl)methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc(Cl)nc1)N1CCCCC1 |
| InChI | InChI=1S/C12H17ClN4.HI/c13-11-5-4-10(8-15-11)9-16-12(14)17-6-2-1-3-7-17;/h4-5,8H,1-3,6-7,9H2,(H2,14,16);1H |
| InChIKey | DWACAFLMFIIYCQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|