C13H20ClIN4 — CID 111041906
2-[(6-chloro-3-pyridinyl)methyl]-1-cyclohexylguanidine;hydroiodide (PubChem CID 111041906) has the molecular formula C13H20ClIN4 and a molecular weight of 394.69 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methyl]-1-cyclohexylguanidine;hydroiodide.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-cyclohexylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111041906 |
| Molecular Formula | C13H20ClIN4 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-cyclohexylguanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc(Cl)nc1)NC1CCCCC1 |
| InChI | InChI=1S/C13H19ClN4.HI/c14-12-7-6-10(8-16-12)9-17-13(15)18-11-4-2-1-3-5-11;/h6-8,11H,1-5,9H2,(H3,15,17,18);1H |
| InChIKey | FAGKREJTLOXGTD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|