C8H11ClN4O — CID 143232776
2-[(6-chloro-3-pyridinyl)methyl]-1-methoxyguanidine (PubChem CID 143232776) has the molecular formula C8H11ClN4O and a molecular weight of 214.66 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methyl]-1-methoxyguanidine.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-methoxyguanidine |
|---|---|
| PubChem CID | 143232776 |
| Molecular Formula | C8H11ClN4O |
| Molecular Weight | 214.66 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-methoxyguanidine |
| SMILES | CON/C(N)=N/Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C8H11ClN4O/c1-14-13-8(10)12-5-6-2-3-7(9)11-4-6/h2-4H,5H2,1H3,(H3,10,12,13) |
| InChIKey | DQECZMXSRLNDHC-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.66 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|