C10H16ClIN4O — CID 110916458
2-[(6-chloro-3-pyridinyl)methyl]-1-(2-methoxyethyl)guanidine;hydroiodide (PubChem CID 110916458) has the molecular formula C10H16ClIN4O and a molecular weight of 370.62 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methyl]-1-(2-methoxyethyl)guanidine;hydroiodide.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-(2-methoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110916458 |
| Molecular Formula | C10H16ClIN4O |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-(2-methoxyethyl)guanidine;hydroiodide |
| SMILES | COCCN/C(N)=N/Cc1ccc(Cl)nc1.I |
| InChI | InChI=1S/C10H15ClN4O.HI/c1-16-5-4-13-10(12)15-7-8-2-3-9(11)14-6-8;/h2-3,6H,4-5,7H2,1H3,(H3,12,13,15);1H |
| InChIKey | CFSKGSVFGKKAGF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|